C13H15NO5 — CID 116819425
(3,5-dimethoxyphenyl) 3-oxopyrrolidine-1-carboxylate (PubChem CID 116819425) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl) 3-oxopyrrolidine-1-carboxylate.
| Compound Name | (3,5-dimethoxyphenyl) 3-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 116819425 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | (3,5-dimethoxyphenyl) 3-oxopyrrolidine-1-carboxylate |
| SMILES | COc1cc(OC)cc(OC(=O)N2CCC(=O)C2)c1 |
| InChI | InChI=1S/C13H15NO5/c1-17-10-5-11(18-2)7-12(6-10)19-13(16)14-4-3-9(15)8-14/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | WHDQMKAZTYZHGM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |