About (3-bromophenyl) 4-oxopiperidine-1-carboxylate
(3-bromophenyl) 4-oxopiperidine-1-carboxylate (PubChem CID 116819231) has the molecular formula C12H12BrNO3
and a molecular weight of 298.14 g/mol. Its IUPAC name is (3-bromophenyl) 4-oxopiperidine-1-carboxylate.
Molecular Properties
| Compound Name | (3-bromophenyl) 4-oxopiperidine-1-carboxylate |
| PubChem CID | 116819231 |
| Molecular Formula | C12H12BrNO3 |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | (3-bromophenyl) 4-oxopiperidine-1-carboxylate |
| SMILES | O=C1CCN(C(=O)Oc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C12H12BrNO3/c13-9-2-1-3-11(8-9)17-12(16)14-6-4-10(15)5-7-14/h1-3,8H,4-7H2 |
| InChIKey | VQHFSNSRUUGBAN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-bromophenyl) 4-oxopiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromophenyl) 4-oxopiperidine-1-carboxylate?
The IUPAC name of (3-bromophenyl) 4-oxopiperidine-1-carboxylate (CID 116819231) is (3-bromophenyl) 4-oxopiperidine-1-carboxylate.
What is the SMILES notation for (3-bromophenyl) 4-oxopiperidine-1-carboxylate?
The canonical SMILES for (3-bromophenyl) 4-oxopiperidine-1-carboxylate is O=C1CCN(C(=O)Oc2cccc(Br)c2)CC1.
What is the InChIKey of (3-bromophenyl) 4-oxopiperidine-1-carboxylate?
The InChIKey is VQHFSNSRUUGBAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrNO3/c13-9-2-1-3-11(8-9)17-12(16)14-6-4-10(15)5-7-14/h1-3,8H,4-7H2.
What are the key properties of (3-bromophenyl) 4-oxopiperidine-1-carboxylate?
(3-bromophenyl) 4-oxopiperidine-1-carboxylate has a molecular weight of 298.14 g/mol, XLogP of 2.61, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromophenyl) 4-oxopiperidine-1-carboxylate is sourced from PubChem (CID 116819231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).