C14H17NO3 — CID 116819416
(2,3,6-trimethylphenyl) 3-oxopyrrolidine-1-carboxylate (PubChem CID 116819416) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is (2,3,6-trimethylphenyl) 3-oxopyrrolidine-1-carboxylate.
| Compound Name | (2,3,6-trimethylphenyl) 3-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 116819416 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (2,3,6-trimethylphenyl) 3-oxopyrrolidine-1-carboxylate |
| SMILES | Cc1ccc(C)c(OC(=O)N2CCC(=O)C2)c1C |
| InChI | InChI=1S/C14H17NO3/c1-9-4-5-10(2)13(11(9)3)18-14(17)15-7-6-12(16)8-15/h4-5H,6-8H2,1-3H3 |
| InChIKey | DJPHGRWFWQPZHC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |