About (1-fluoronaphthalen-2-yl) piperidine-1-carboxylate
(1-fluoronaphthalen-2-yl) piperidine-1-carboxylate (PubChem CID 170622073) has the molecular formula C16H16FNO2
and a molecular weight of 273.31 g/mol. Its IUPAC name is (1-fluoronaphthalen-2-yl) piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (1-fluoronaphthalen-2-yl) piperidine-1-carboxylate |
| PubChem CID | 170622073 |
| Molecular Formula | C16H16FNO2 |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (1-fluoronaphthalen-2-yl) piperidine-1-carboxylate |
| SMILES | O=C(Oc1ccc2ccccc2c1F)N1CCCCC1 |
| InChI | InChI=1S/C16H16FNO2/c17-15-13-7-3-2-6-12(13)8-9-14(15)20-16(19)18-10-4-1-5-11-18/h2-3,6-9H,1,4-5,10-11H2 |
| InChIKey | LKKWYAMQOJTAAD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-fluoronaphthalen-2-yl) piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-fluoronaphthalen-2-yl) piperidine-1-carboxylate?
The IUPAC name of (1-fluoronaphthalen-2-yl) piperidine-1-carboxylate (CID 170622073) is (1-fluoronaphthalen-2-yl) piperidine-1-carboxylate.
What is the SMILES notation for (1-fluoronaphthalen-2-yl) piperidine-1-carboxylate?
The canonical SMILES for (1-fluoronaphthalen-2-yl) piperidine-1-carboxylate is O=C(Oc1ccc2ccccc2c1F)N1CCCCC1.
What is the InChIKey of (1-fluoronaphthalen-2-yl) piperidine-1-carboxylate?
The InChIKey is LKKWYAMQOJTAAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16FNO2/c17-15-13-7-3-2-6-12(13)8-9-14(15)20-16(19)18-10-4-1-5-11-18/h2-3,6-9H,1,4-5,10-11H2.
What are the key properties of (1-fluoronaphthalen-2-yl) piperidine-1-carboxylate?
(1-fluoronaphthalen-2-yl) piperidine-1-carboxylate has a molecular weight of 273.31 g/mol, XLogP of 3.96, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-fluoronaphthalen-2-yl) piperidine-1-carboxylate is sourced from PubChem (CID 170622073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).