(1-acetylnaphthalen-2-yl) 4-benzylpiperidine-1-carboxylate

C25H25NO3 — CID 11625234

IUPAC(1-acetylnaphthalen-2-yl) 4-benzylpiperidine-1-carboxylate
SMILESCC(=O)c1c(OC(=O)N2CCC(Cc3ccccc3)CC2)ccc2ccccc12
InChIInChI=1S/C25H25NO3/c1-18(27)24-22-10-6-5-9-21(22)11-12-23(24)29-25(28)26-15-13-20(14-16-26)17-19-7-3-2-4-8-19/h2-12,20H,13-17H2,1H3
InChIKeyJRHRLNLILANBSR-UHFFFAOYSA-N
MW387.48 g/mol
LogP5.50
Rot. Bonds4

About (1-acetylnaphthalen-2-yl) 4-benzylpiperidine-1-carboxylate

(1-acetylnaphthalen-2-yl) 4-benzylpiperidine-1-carboxylate (PubChem CID 11625234) has the molecular formula C25H25NO3 and a molecular weight of 387.48 g/mol. Its IUPAC name is (1-acetylnaphthalen-2-yl) 4-benzylpiperidine-1-carboxylate.

Molecular Properties

Compound Name(1-acetylnaphthalen-2-yl) 4-benzylpiperidine-1-carboxylate
PubChem CID11625234
Molecular FormulaC25H25NO3
Molecular Weight387.48 g/mol
Exact Mass387.18
IUPAC Name(1-acetylnaphthalen-2-yl) 4-benzylpiperidine-1-carboxylate
SMILESCC(=O)c1c(OC(=O)N2CCC(Cc3ccccc3)CC2)ccc2ccccc12
InChIInChI=1S/C25H25NO3/c1-18(27)24-22-10-6-5-9-21(22)11-12-23(24)29-25(28)26-15-13-20(14-16-26)17-19-7-3-2-4-8-19/h2-12,20H,13-17H2,1H3
InChIKeyJRHRLNLILANBSR-UHFFFAOYSA-N
XLogP5.50
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms29
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500387.48
LogP ≤ 55.50
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze (1-acetylnaphthalen-2-yl) 4-benzylpiperidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1-acetylnaphthalen-2-yl) 4-benzylpiperidine-1-carboxylate?
The IUPAC name of (1-acetylnaphthalen-2-yl) 4-benzylpiperidine-1-carboxylate (CID 11625234) is (1-acetylnaphthalen-2-yl) 4-benzylpiperidine-1-carboxylate.
What is the SMILES notation for (1-acetylnaphthalen-2-yl) 4-benzylpiperidine-1-carboxylate?
The canonical SMILES for (1-acetylnaphthalen-2-yl) 4-benzylpiperidine-1-carboxylate is CC(=O)c1c(OC(=O)N2CCC(Cc3ccccc3)CC2)ccc2ccccc12.
What is the InChIKey of (1-acetylnaphthalen-2-yl) 4-benzylpiperidine-1-carboxylate?
The InChIKey is JRHRLNLILANBSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25NO3/c1-18(27)24-22-10-6-5-9-21(22)11-12-23(24)29-25(28)26-15-13-20(14-16-26)17-19-7-3-2-4-8-19/h2-12,20H,13-17H2,1H3.
What are the key properties of (1-acetylnaphthalen-2-yl) 4-benzylpiperidine-1-carboxylate?
(1-acetylnaphthalen-2-yl) 4-benzylpiperidine-1-carboxylate has a molecular weight of 387.48 g/mol, XLogP of 5.50, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-acetylnaphthalen-2-yl) 4-benzylpiperidine-1-carboxylate is sourced from PubChem (CID 11625234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).