About isoquinolin-3-yl 4-benzylpiperidine-1-carboxylate
isoquinolin-3-yl 4-benzylpiperidine-1-carboxylate (PubChem CID 59825511) has the molecular formula C22H22N2O2
and a molecular weight of 346.43 g/mol. Its IUPAC name is isoquinolin-3-yl 4-benzylpiperidine-1-carboxylate.
Molecular Properties
| Compound Name | isoquinolin-3-yl 4-benzylpiperidine-1-carboxylate |
| PubChem CID | 59825511 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | isoquinolin-3-yl 4-benzylpiperidine-1-carboxylate |
| SMILES | O=C(Oc1cc2ccccc2cn1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H22N2O2/c25-22(26-21-15-19-8-4-5-9-20(19)16-23-21)24-12-10-18(11-13-24)14-17-6-2-1-3-7-17/h1-9,15-16,18H,10-14H2 |
| InChIKey | NQZAALOKNUZVGM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze isoquinolin-3-yl 4-benzylpiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isoquinolin-3-yl 4-benzylpiperidine-1-carboxylate?
The IUPAC name of isoquinolin-3-yl 4-benzylpiperidine-1-carboxylate (CID 59825511) is isoquinolin-3-yl 4-benzylpiperidine-1-carboxylate.
What is the SMILES notation for isoquinolin-3-yl 4-benzylpiperidine-1-carboxylate?
The canonical SMILES for isoquinolin-3-yl 4-benzylpiperidine-1-carboxylate is O=C(Oc1cc2ccccc2cn1)N1CCC(Cc2ccccc2)CC1.
What is the InChIKey of isoquinolin-3-yl 4-benzylpiperidine-1-carboxylate?
The InChIKey is NQZAALOKNUZVGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N2O2/c25-22(26-21-15-19-8-4-5-9-20(19)16-23-21)24-12-10-18(11-13-24)14-17-6-2-1-3-7-17/h1-9,15-16,18H,10-14H2.
What are the key properties of isoquinolin-3-yl 4-benzylpiperidine-1-carboxylate?
isoquinolin-3-yl 4-benzylpiperidine-1-carboxylate has a molecular weight of 346.43 g/mol, XLogP of 4.69, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for isoquinolin-3-yl 4-benzylpiperidine-1-carboxylate is sourced from PubChem (CID 59825511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).