About [8-(piperidine-1-carbonyloxy)naphthalen-2-yl] piperidine-1-carboxylate
[8-(piperidine-1-carbonyloxy)naphthalen-2-yl] piperidine-1-carboxylate (PubChem CID 23766816) has the molecular formula C22H26N2O4
and a molecular weight of 382.46 g/mol. Its IUPAC name is [8-(piperidine-1-carbonyloxy)naphthalen-2-yl] piperidine-1-carboxylate.
Molecular Properties
| Compound Name | [8-(piperidine-1-carbonyloxy)naphthalen-2-yl] piperidine-1-carboxylate |
| PubChem CID | 23766816 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | [8-(piperidine-1-carbonyloxy)naphthalen-2-yl] piperidine-1-carboxylate |
| SMILES | O=C(Oc1ccc2cccc(OC(=O)N3CCCCC3)c2c1)N1CCCCC1 |
| InChI | InChI=1S/C22H26N2O4/c25-21(23-12-3-1-4-13-23)27-18-11-10-17-8-7-9-20(19(17)16-18)28-22(26)24-14-5-2-6-15-24/h7-11,16H,1-6,12-15H2 |
| InChIKey | GDGXKOWYESCVTQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [8-(piperidine-1-carbonyloxy)naphthalen-2-yl] piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [8-(piperidine-1-carbonyloxy)naphthalen-2-yl] piperidine-1-carboxylate?
The IUPAC name of [8-(piperidine-1-carbonyloxy)naphthalen-2-yl] piperidine-1-carboxylate (CID 23766816) is [8-(piperidine-1-carbonyloxy)naphthalen-2-yl] piperidine-1-carboxylate.
What is the SMILES notation for [8-(piperidine-1-carbonyloxy)naphthalen-2-yl] piperidine-1-carboxylate?
The canonical SMILES for [8-(piperidine-1-carbonyloxy)naphthalen-2-yl] piperidine-1-carboxylate is O=C(Oc1ccc2cccc(OC(=O)N3CCCCC3)c2c1)N1CCCCC1.
What is the InChIKey of [8-(piperidine-1-carbonyloxy)naphthalen-2-yl] piperidine-1-carboxylate?
The InChIKey is GDGXKOWYESCVTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N2O4/c25-21(23-12-3-1-4-13-23)27-18-11-10-17-8-7-9-20(19(17)16-18)28-22(26)24-14-5-2-6-15-24/h7-11,16H,1-6,12-15H2.
What are the key properties of [8-(piperidine-1-carbonyloxy)naphthalen-2-yl] piperidine-1-carboxylate?
[8-(piperidine-1-carbonyloxy)naphthalen-2-yl] piperidine-1-carboxylate has a molecular weight of 382.46 g/mol, XLogP of 4.81, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [8-(piperidine-1-carbonyloxy)naphthalen-2-yl] piperidine-1-carboxylate is sourced from PubChem (CID 23766816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).