C25H44N2O4S — CID 10766697
[2,6-di(propan-2-yl)phenyl] N-(dihexylsulfamoyl)carbamate (PubChem CID 10766697) has the molecular formula C25H44N2O4S and a molecular weight of 468.70 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl] N-(dihexylsulfamoyl)carbamate.
| Compound Name | [2,6-di(propan-2-yl)phenyl] N-(dihexylsulfamoyl)carbamate |
|---|---|
| PubChem CID | 10766697 |
| Molecular Formula | C25H44N2O4S |
| Molecular Weight | 468.70 g/mol |
| Exact Mass | 468.30 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl] N-(dihexylsulfamoyl)carbamate |
| SMILES | CCCCCCN(CCCCCC)S(=O)(=O)NC(=O)Oc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C25H44N2O4S/c1-7-9-11-13-18-27(19-14-12-10-8-2)32(29,30)26-25(28)31-24-22(20(3)4)16-15-17-23(24)21(5)6/h15-17,20-21H,7-14,18-19H2,1-6H3,(H,26,28) |
| InChIKey | JFQJMFYZXFSZPL-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.70 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|