C30H53NO4S — CID 57073198
[2,6-di(propan-2-yl)phenyl] 2-(dioctylsulfamoyl)acetate (PubChem CID 57073198) has the molecular formula C30H53NO4S and a molecular weight of 523.82 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl] 2-(dioctylsulfamoyl)acetate.
| Compound Name | [2,6-di(propan-2-yl)phenyl] 2-(dioctylsulfamoyl)acetate |
|---|---|
| PubChem CID | 57073198 |
| Molecular Formula | C30H53NO4S |
| Molecular Weight | 523.82 g/mol |
| Exact Mass | 523.37 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl] 2-(dioctylsulfamoyl)acetate |
| SMILES | CCCCCCCCN(CCCCCCCC)S(=O)(=O)CC(=O)Oc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C30H53NO4S/c1-7-9-11-13-15-17-22-31(23-18-16-14-12-10-8-2)36(33,34)24-29(32)35-30-27(25(3)4)20-19-21-28(30)26(5)6/h19-21,25-26H,7-18,22-24H2,1-6H3 |
| InChIKey | KEXAQJAJWKEQCH-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.82 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|