C19H31NO5 — CID 167549248
[2-[2,6-di(propan-2-yl)phenoxy]-2-oxoethyl] 2-(dimethylamino)-2-hydroxyacetate;methane (PubChem CID 167549248) has the molecular formula C19H31NO5 and a molecular weight of 353.46 g/mol. Its IUPAC name is [2-[2,6-di(propan-2-yl)phenoxy]-2-oxoethyl] 2-(dimethylamino)-2-hydroxyacetate;methane.
| Compound Name | [2-[2,6-di(propan-2-yl)phenoxy]-2-oxoethyl] 2-(dimethylamino)-2-hydroxyacetate;methane |
|---|---|
| PubChem CID | 167549248 |
| Molecular Formula | C19H31NO5 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | [2-[2,6-di(propan-2-yl)phenoxy]-2-oxoethyl] 2-(dimethylamino)-2-hydroxyacetate;methane |
| SMILES | C.CC(C)c1cccc(C(C)C)c1OC(=O)COC(=O)C(O)N(C)C |
| InChI | InChI=1S/C18H27NO5.CH4/c1-11(2)13-8-7-9-14(12(3)4)16(13)24-15(20)10-23-18(22)17(21)19(5)6;/h7-9,11-12,17,21H,10H2,1-6H3;1H4 |
| InChIKey | CETQVEJRFFVQKN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|