C21H33NO5 — CID 167669029
[2-[2,6-di(propan-2-yl)phenoxy]-2-oxoethyl] 2-morpholin-4-ylacetate;methane (PubChem CID 167669029) has the molecular formula C21H33NO5 and a molecular weight of 379.50 g/mol. Its IUPAC name is [2-[2,6-di(propan-2-yl)phenoxy]-2-oxoethyl] 2-morpholin-4-ylacetate;methane.
| Compound Name | [2-[2,6-di(propan-2-yl)phenoxy]-2-oxoethyl] 2-morpholin-4-ylacetate;methane |
|---|---|
| PubChem CID | 167669029 |
| Molecular Formula | C21H33NO5 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | [2-[2,6-di(propan-2-yl)phenoxy]-2-oxoethyl] 2-morpholin-4-ylacetate;methane |
| SMILES | C.CC(C)c1cccc(C(C)C)c1OC(=O)COC(=O)CN1CCOCC1 |
| InChI | InChI=1S/C20H29NO5.CH4/c1-14(2)16-6-5-7-17(15(3)4)20(16)26-19(23)13-25-18(22)12-21-8-10-24-11-9-21;/h5-7,14-15H,8-13H2,1-4H3;1H4 |
| InChIKey | TVDIOSBRYNQXJQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|