About (2-nitrophenyl) 2-morpholin-4-ylacetate
(2-nitrophenyl) 2-morpholin-4-ylacetate (PubChem CID 164900000) has the molecular formula C12H14N2O5
and a molecular weight of 266.25 g/mol. Its IUPAC name is (2-nitrophenyl) 2-morpholin-4-ylacetate.
Molecular Properties
| Compound Name | (2-nitrophenyl) 2-morpholin-4-ylacetate |
| PubChem CID | 164900000 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | (2-nitrophenyl) 2-morpholin-4-ylacetate |
| SMILES | O=C(CN1CCOCC1)Oc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14N2O5/c15-12(9-13-5-7-18-8-6-13)19-11-4-2-1-3-10(11)14(16)17/h1-4H,5-9H2 |
| InChIKey | JNGBUNUCRYDNBB-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-nitrophenyl) 2-morpholin-4-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-nitrophenyl) 2-morpholin-4-ylacetate?
The IUPAC name of (2-nitrophenyl) 2-morpholin-4-ylacetate (CID 164900000) is (2-nitrophenyl) 2-morpholin-4-ylacetate.
What is the SMILES notation for (2-nitrophenyl) 2-morpholin-4-ylacetate?
The canonical SMILES for (2-nitrophenyl) 2-morpholin-4-ylacetate is O=C(CN1CCOCC1)Oc1ccccc1[N+](=O)[O-].
What is the InChIKey of (2-nitrophenyl) 2-morpholin-4-ylacetate?
The InChIKey is JNGBUNUCRYDNBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O5/c15-12(9-13-5-7-18-8-6-13)19-11-4-2-1-3-10(11)14(16)17/h1-4H,5-9H2.
What are the key properties of (2-nitrophenyl) 2-morpholin-4-ylacetate?
(2-nitrophenyl) 2-morpholin-4-ylacetate has a molecular weight of 266.25 g/mol, XLogP of 0.83, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-nitrophenyl) 2-morpholin-4-ylacetate is sourced from PubChem (CID 164900000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).