About 2-chloro-3-nitrophenol;4-[2-(2-chloro-3-nitrophenoxy)ethyl]morpholine
2-chloro-3-nitrophenol;4-[2-(2-chloro-3-nitrophenoxy)ethyl]morpholine (PubChem CID 159494926) has the molecular formula C18H19Cl2N3O7
and a molecular weight of 460.27 g/mol. Its IUPAC name is 2-chloro-3-nitrophenol;4-[2-(2-chloro-3-nitrophenoxy)ethyl]morpholine.
Molecular Properties
| Compound Name | 2-chloro-3-nitrophenol;4-[2-(2-chloro-3-nitrophenoxy)ethyl]morpholine |
| PubChem CID | 159494926 |
| Molecular Formula | C18H19Cl2N3O7 |
| Molecular Weight | 460.27 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | 2-chloro-3-nitrophenol;4-[2-(2-chloro-3-nitrophenoxy)ethyl]morpholine |
| SMILES | O=[N+]([O-])c1cccc(O)c1Cl.O=[N+]([O-])c1cccc(OCCN2CCOCC2)c1Cl |
| InChI | InChI=1S/C12H15ClN2O4.C6H4ClNO3/c13-12-10(15(16)17)2-1-3-11(12)19-9-6-14-4-7-18-8-5-14;7-6-4(8(10)11)2-1-3-5(6)9/h1-3H,4-9H2;1-3,9H |
| InChIKey | LYQXAXXAJRZNJQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 128.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.27 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-nitrophenol;4-[2-(2-chloro-3-nitrophenoxy)ethyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-nitrophenol;4-[2-(2-chloro-3-nitrophenoxy)ethyl]morpholine?
The IUPAC name of 2-chloro-3-nitrophenol;4-[2-(2-chloro-3-nitrophenoxy)ethyl]morpholine (CID 159494926) is 2-chloro-3-nitrophenol;4-[2-(2-chloro-3-nitrophenoxy)ethyl]morpholine.
What is the SMILES notation for 2-chloro-3-nitrophenol;4-[2-(2-chloro-3-nitrophenoxy)ethyl]morpholine?
The canonical SMILES for 2-chloro-3-nitrophenol;4-[2-(2-chloro-3-nitrophenoxy)ethyl]morpholine is O=[N+]([O-])c1cccc(O)c1Cl.O=[N+]([O-])c1cccc(OCCN2CCOCC2)c1Cl.
What is the InChIKey of 2-chloro-3-nitrophenol;4-[2-(2-chloro-3-nitrophenoxy)ethyl]morpholine?
The InChIKey is LYQXAXXAJRZNJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClN2O4.C6H4ClNO3/c13-12-10(15(16)17)2-1-3-11(12)19-9-6-14-4-7-18-8-5-14;7-6-4(8(10)11)2-1-3-5(6)9/h1-3H,4-9H2;1-3,9H.
What are the key properties of 2-chloro-3-nitrophenol;4-[2-(2-chloro-3-nitrophenoxy)ethyl]morpholine?
2-chloro-3-nitrophenol;4-[2-(2-chloro-3-nitrophenoxy)ethyl]morpholine has a molecular weight of 460.27 g/mol, XLogP of 3.91, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-nitrophenol;4-[2-(2-chloro-3-nitrophenoxy)ethyl]morpholine is sourced from PubChem (CID 159494926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).