C12H19N3O2 — CID 91269103
3-(2-morpholin-4-ylethoxy)benzene-1,2-diamine (PubChem CID 91269103) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 3-(2-morpholin-4-ylethoxy)benzene-1,2-diamine.
| Compound Name | 3-(2-morpholin-4-ylethoxy)benzene-1,2-diamine |
|---|---|
| PubChem CID | 91269103 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 3-(2-morpholin-4-ylethoxy)benzene-1,2-diamine |
| SMILES | Nc1cccc(OCCN2CCOCC2)c1N |
| InChI | InChI=1S/C12H19N3O2/c13-10-2-1-3-11(12(10)14)17-9-6-15-4-7-16-8-5-15/h1-3H,4-9,13-14H2 |
| InChIKey | GJAJZMAVTIPOGD-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|