C14H22N2O2 — CID 147491623
N,N-dimethyl-2-(2-morpholin-4-ylethoxy)aniline (PubChem CID 147491623) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is N,N-dimethyl-2-(2-morpholin-4-ylethoxy)aniline.
| Compound Name | N,N-dimethyl-2-(2-morpholin-4-ylethoxy)aniline |
|---|---|
| PubChem CID | 147491623 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | N,N-dimethyl-2-(2-morpholin-4-ylethoxy)aniline |
| SMILES | CN(C)c1ccccc1OCCN1CCOCC1 |
| InChI | InChI=1S/C14H22N2O2/c1-15(2)13-5-3-4-6-14(13)18-12-9-16-7-10-17-11-8-16/h3-6H,7-12H2,1-2H3 |
| InChIKey | FFQFUKFAQAAOCQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |