C12H16Cl2N2O2 — CID 142799192
N,N-dichloro-2-(2-morpholin-4-ylethoxy)aniline (PubChem CID 142799192) has the molecular formula C12H16Cl2N2O2 and a molecular weight of 291.18 g/mol. Its IUPAC name is N,N-dichloro-2-(2-morpholin-4-ylethoxy)aniline.
| Compound Name | N,N-dichloro-2-(2-morpholin-4-ylethoxy)aniline |
|---|---|
| PubChem CID | 142799192 |
| Molecular Formula | C12H16Cl2N2O2 |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | N,N-dichloro-2-(2-morpholin-4-ylethoxy)aniline |
| SMILES | ClN(Cl)c1ccccc1OCCN1CCOCC1 |
| InChI | InChI=1S/C12H16Cl2N2O2/c13-16(14)11-3-1-2-4-12(11)18-10-7-15-5-8-17-9-6-15/h1-4H,5-10H2 |
| InChIKey | QNEHIDAMRUAGEX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|