C28H32O4 — CID 101200141
[2,6-di(propan-2-yl)phenyl] 3-hydroxy-2-[hydroxy(phenyl)methyl]-3-phenylpropanoate (PubChem CID 101200141) has the molecular formula C28H32O4 and a molecular weight of 432.56 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl] 3-hydroxy-2-[hydroxy(phenyl)methyl]-3-phenylpropanoate.
| Compound Name | [2,6-di(propan-2-yl)phenyl] 3-hydroxy-2-[hydroxy(phenyl)methyl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 101200141 |
| Molecular Formula | C28H32O4 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl] 3-hydroxy-2-[hydroxy(phenyl)methyl]-3-phenylpropanoate |
| SMILES | CC(C)c1cccc(C(C)C)c1OC(=O)C(C(O)c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C28H32O4/c1-18(2)22-16-11-17-23(19(3)4)27(22)32-28(31)24(25(29)20-12-7-5-8-13-20)26(30)21-14-9-6-10-15-21/h5-19,24-26,29-30H,1-4H3 |
| InChIKey | WSKVUIUFQSIJFA-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|