C21H28N2O2 — CID 15675184
[2,6-di(propan-2-yl)phenyl] N-(2-amino-2-phenylethyl)carbamate (PubChem CID 15675184) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl] N-(2-amino-2-phenylethyl)carbamate.
| Compound Name | [2,6-di(propan-2-yl)phenyl] N-(2-amino-2-phenylethyl)carbamate |
|---|---|
| PubChem CID | 15675184 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl] N-(2-amino-2-phenylethyl)carbamate |
| SMILES | CC(C)c1cccc(C(C)C)c1OC(=O)NCC(N)c1ccccc1 |
| InChI | InChI=1S/C21H28N2O2/c1-14(2)17-11-8-12-18(15(3)4)20(17)25-21(24)23-13-19(22)16-9-6-5-7-10-16/h5-12,14-15,19H,13,22H2,1-4H3,(H,23,24) |
| InChIKey | SSWIYARFFICGPV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |