C23H29NO2 — CID 174786679
[2-(1-cyclopropylethyl)-6-propan-2-ylphenyl] N-(2-phenylethyl)carbamate (PubChem CID 174786679) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is [2-(1-cyclopropylethyl)-6-propan-2-ylphenyl] N-(2-phenylethyl)carbamate.
| Compound Name | [2-(1-cyclopropylethyl)-6-propan-2-ylphenyl] N-(2-phenylethyl)carbamate |
|---|---|
| PubChem CID | 174786679 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | [2-(1-cyclopropylethyl)-6-propan-2-ylphenyl] N-(2-phenylethyl)carbamate |
| SMILES | CC(C)c1cccc(C(C)C2CC2)c1OC(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C23H29NO2/c1-16(2)20-10-7-11-21(17(3)19-12-13-19)22(20)26-23(25)24-15-14-18-8-5-4-6-9-18/h4-11,16-17,19H,12-15H2,1-3H3,(H,24,25) |
| InChIKey | XKGYLYUQOYPWBK-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |