C18H27NO3 — CID 174823269
[2-(1-cyclopropylethyl)-6-propan-2-ylphenoxy]methyl 3-aminopropanoate (PubChem CID 174823269) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is [2-(1-cyclopropylethyl)-6-propan-2-ylphenoxy]methyl 3-aminopropanoate.
| Compound Name | [2-(1-cyclopropylethyl)-6-propan-2-ylphenoxy]methyl 3-aminopropanoate |
|---|---|
| PubChem CID | 174823269 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | [2-(1-cyclopropylethyl)-6-propan-2-ylphenoxy]methyl 3-aminopropanoate |
| SMILES | CC(C)c1cccc(C(C)C2CC2)c1OCOC(=O)CCN |
| InChI | InChI=1S/C18H27NO3/c1-12(2)15-5-4-6-16(13(3)14-7-8-14)18(15)22-11-21-17(20)9-10-19/h4-6,12-14H,7-11,19H2,1-3H3 |
| InChIKey | ZZUBRCNVWLJUSU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|