About [2-(1-cyclopropylethyl)-6-propan-2-ylphenoxy]methyl 3-aminopropanoate
[2-(1-cyclopropylethyl)-6-propan-2-ylphenoxy]methyl 3-aminopropanoate (PubChem CID 174823269) has the molecular formula C18H27NO3
and a molecular weight of 305.42 g/mol. Its IUPAC name is [2-(1-cyclopropylethyl)-6-propan-2-ylphenoxy]methyl 3-aminopropanoate.
Molecular Properties
| Compound Name | [2-(1-cyclopropylethyl)-6-propan-2-ylphenoxy]methyl 3-aminopropanoate |
| PubChem CID | 174823269 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | [2-(1-cyclopropylethyl)-6-propan-2-ylphenoxy]methyl 3-aminopropanoate |
| SMILES | CC(C)c1cccc(C(C)C2CC2)c1OCOC(=O)CCN |
| InChI | InChI=1S/C18H27NO3/c1-12(2)15-5-4-6-16(13(3)14-7-8-14)18(15)22-11-21-17(20)9-10-19/h4-6,12-14H,7-11,19H2,1-3H3 |
| InChIKey | ZZUBRCNVWLJUSU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [2-(1-cyclopropylethyl)-6-propan-2-ylphenoxy]methyl 3-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1-cyclopropylethyl)-6-propan-2-ylphenoxy]methyl 3-aminopropanoate?
The IUPAC name of [2-(1-cyclopropylethyl)-6-propan-2-ylphenoxy]methyl 3-aminopropanoate (CID 174823269) is [2-(1-cyclopropylethyl)-6-propan-2-ylphenoxy]methyl 3-aminopropanoate.
What is the SMILES notation for [2-(1-cyclopropylethyl)-6-propan-2-ylphenoxy]methyl 3-aminopropanoate?
The canonical SMILES for [2-(1-cyclopropylethyl)-6-propan-2-ylphenoxy]methyl 3-aminopropanoate is CC(C)c1cccc(C(C)C2CC2)c1OCOC(=O)CCN.
What is the InChIKey of [2-(1-cyclopropylethyl)-6-propan-2-ylphenoxy]methyl 3-aminopropanoate?
The InChIKey is ZZUBRCNVWLJUSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27NO3/c1-12(2)15-5-4-6-16(13(3)14-7-8-14)18(15)22-11-21-17(20)9-10-19/h4-6,12-14H,7-11,19H2,1-3H3.
What are the key properties of [2-(1-cyclopropylethyl)-6-propan-2-ylphenoxy]methyl 3-aminopropanoate?
[2-(1-cyclopropylethyl)-6-propan-2-ylphenoxy]methyl 3-aminopropanoate has a molecular weight of 305.42 g/mol, XLogP of 3.55, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1-cyclopropylethyl)-6-propan-2-ylphenoxy]methyl 3-aminopropanoate is sourced from PubChem (CID 174823269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).