C23H35O9P — CID 118899079
2-[[2-[(1R)-1-cyclopropylethyl]-6-propan-2-ylphenoxy]methoxy-(2-ethoxy-2-oxoethoxy)phosphoryl]oxybutanoic acid (PubChem CID 118899079) has the molecular formula C23H35O9P and a molecular weight of 486.50 g/mol. Its IUPAC name is 2-[[2-[(1R)-1-cyclopropylethyl]-6-propan-2-ylphenoxy]methoxy-(2-ethoxy-2-oxoethoxy)phosphoryl]oxybutanoic acid.
| Compound Name | 2-[[2-[(1R)-1-cyclopropylethyl]-6-propan-2-ylphenoxy]methoxy-(2-ethoxy-2-oxoethoxy)phosphoryl]oxybutanoic acid |
|---|---|
| PubChem CID | 118899079 |
| Molecular Formula | C23H35O9P |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 2-[[2-[(1R)-1-cyclopropylethyl]-6-propan-2-ylphenoxy]methoxy-(2-ethoxy-2-oxoethoxy)phosphoryl]oxybutanoic acid |
| SMILES | CCOC(=O)COP(=O)(OCOc1c(C(C)C)cccc1[C@H](C)C1CC1)OC(CC)C(=O)O |
| InChI | InChI=1S/C23H35O9P/c1-6-20(23(25)26)32-33(27,30-13-21(24)28-7-2)31-14-29-22-18(15(3)4)9-8-10-19(22)16(5)17-11-12-17/h8-10,15-17,20H,6-7,11-14H2,1-5H3,(H,25,26)/t16-,20?,33?/m1/s1 |
| InChIKey | RNLQQJJUTZJQRK-CEHIRFMGSA-N |
| XLogP | 5.24 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|