C22H35N2O6P — CID 118899043
2-[[[2-(1-cyclopropylethyl)-6-propan-2-ylphenoxy]-[(2-ethoxy-2-oxoethyl)amino]phosphoryl]amino]butanoic acid (PubChem CID 118899043) has the molecular formula C22H35N2O6P and a molecular weight of 454.50 g/mol. Its IUPAC name is 2-[[[2-(1-cyclopropylethyl)-6-propan-2-ylphenoxy]-[(2-ethoxy-2-oxoethyl)amino]phosphoryl]amino]butanoic acid.
| Compound Name | 2-[[[2-(1-cyclopropylethyl)-6-propan-2-ylphenoxy]-[(2-ethoxy-2-oxoethyl)amino]phosphoryl]amino]butanoic acid |
|---|---|
| PubChem CID | 118899043 |
| Molecular Formula | C22H35N2O6P |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 2-[[[2-(1-cyclopropylethyl)-6-propan-2-ylphenoxy]-[(2-ethoxy-2-oxoethyl)amino]phosphoryl]amino]butanoic acid |
| SMILES | CCOC(=O)CNP(=O)(NC(CC)C(=O)O)Oc1c(C(C)C)cccc1C(C)C1CC1 |
| InChI | InChI=1S/C22H35N2O6P/c1-6-19(22(26)27)24-31(28,23-13-20(25)29-7-2)30-21-17(14(3)4)9-8-10-18(21)15(5)16-11-12-16/h8-10,14-16,19H,6-7,11-13H2,1-5H3,(H,26,27)(H2,23,24,28) |
| InChIKey | HKTAAZUWEYAOFR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|