About ethyl 2-[[[2,6-di(propan-2-yl)phenoxy]-[(2-ethoxy-2-oxoethyl)amino]phosphoryl]amino]acetate
ethyl 2-[[[2,6-di(propan-2-yl)phenoxy]-[(2-ethoxy-2-oxoethyl)amino]phosphoryl]amino]acetate (PubChem CID 118909709) has the molecular formula C20H33N2O6P
and a molecular weight of 428.47 g/mol. Its IUPAC name is ethyl 2-[[[2,6-di(propan-2-yl)phenoxy]-[(2-ethoxy-2-oxoethyl)amino]phosphoryl]amino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[[[2,6-di(propan-2-yl)phenoxy]-[(2-ethoxy-2-oxoethyl)amino]phosphoryl]amino]acetate |
| PubChem CID | 118909709 |
| Molecular Formula | C20H33N2O6P |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | ethyl 2-[[[2,6-di(propan-2-yl)phenoxy]-[(2-ethoxy-2-oxoethyl)amino]phosphoryl]amino]acetate |
| SMILES | CCOC(=O)CNP(=O)(NCC(=O)OCC)Oc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C20H33N2O6P/c1-7-26-18(23)12-21-29(25,22-13-19(24)27-8-2)28-20-16(14(3)4)10-9-11-17(20)15(5)6/h9-11,14-15H,7-8,12-13H2,1-6H3,(H2,21,22,25) |
| InChIKey | IRFGDHLSGKNOPD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[[[2,6-di(propan-2-yl)phenoxy]-[(2-ethoxy-2-oxoethyl)amino]phosphoryl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[[2,6-di(propan-2-yl)phenoxy]-[(2-ethoxy-2-oxoethyl)amino]phosphoryl]amino]acetate?
The IUPAC name of ethyl 2-[[[2,6-di(propan-2-yl)phenoxy]-[(2-ethoxy-2-oxoethyl)amino]phosphoryl]amino]acetate (CID 118909709) is ethyl 2-[[[2,6-di(propan-2-yl)phenoxy]-[(2-ethoxy-2-oxoethyl)amino]phosphoryl]amino]acetate.
What is the SMILES notation for ethyl 2-[[[2,6-di(propan-2-yl)phenoxy]-[(2-ethoxy-2-oxoethyl)amino]phosphoryl]amino]acetate?
The canonical SMILES for ethyl 2-[[[2,6-di(propan-2-yl)phenoxy]-[(2-ethoxy-2-oxoethyl)amino]phosphoryl]amino]acetate is CCOC(=O)CNP(=O)(NCC(=O)OCC)Oc1c(C(C)C)cccc1C(C)C.
What is the InChIKey of ethyl 2-[[[2,6-di(propan-2-yl)phenoxy]-[(2-ethoxy-2-oxoethyl)amino]phosphoryl]amino]acetate?
The InChIKey is IRFGDHLSGKNOPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H33N2O6P/c1-7-26-18(23)12-21-29(25,22-13-19(24)27-8-2)28-20-16(14(3)4)10-9-11-17(20)15(5)6/h9-11,14-15H,7-8,12-13H2,1-6H3,(H2,21,22,25).
What are the key properties of ethyl 2-[[[2,6-di(propan-2-yl)phenoxy]-[(2-ethoxy-2-oxoethyl)amino]phosphoryl]amino]acetate?
ethyl 2-[[[2,6-di(propan-2-yl)phenoxy]-[(2-ethoxy-2-oxoethyl)amino]phosphoryl]amino]acetate has a molecular weight of 428.47 g/mol, XLogP of 3.73, 12 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[[2,6-di(propan-2-yl)phenoxy]-[(2-ethoxy-2-oxoethyl)amino]phosphoryl]amino]acetate is sourced from PubChem (CID 118909709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).