C18H30NO5P — CID 174885101
2-[[[2,6-di(propan-2-yl)phenoxy]-(hydroxymethyl)phosphoryl]amino]-2-methylbutanoic acid (PubChem CID 174885101) has the molecular formula C18H30NO5P and a molecular weight of 371.41 g/mol. Its IUPAC name is 2-[[[2,6-di(propan-2-yl)phenoxy]-(hydroxymethyl)phosphoryl]amino]-2-methylbutanoic acid.
| Compound Name | 2-[[[2,6-di(propan-2-yl)phenoxy]-(hydroxymethyl)phosphoryl]amino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 174885101 |
| Molecular Formula | C18H30NO5P |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 2-[[[2,6-di(propan-2-yl)phenoxy]-(hydroxymethyl)phosphoryl]amino]-2-methylbutanoic acid |
| SMILES | CCC(C)(NP(=O)(CO)Oc1c(C(C)C)cccc1C(C)C)C(=O)O |
| InChI | InChI=1S/C18H30NO5P/c1-7-18(6,17(21)22)19-25(23,11-20)24-16-14(12(2)3)9-8-10-15(16)13(4)5/h8-10,12-13,20H,7,11H2,1-6H3,(H,19,23)(H,21,22) |
| InChIKey | SMULFAAMPCNILR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|