C20H35N2O4P — CID 174884485
2-[[(dimethylamino)methyl-[2,6-di(propan-2-yl)phenoxy]phosphoryl]amino]-2-methylbutanoic acid (PubChem CID 174884485) has the molecular formula C20H35N2O4P and a molecular weight of 398.48 g/mol. Its IUPAC name is 2-[[(dimethylamino)methyl-[2,6-di(propan-2-yl)phenoxy]phosphoryl]amino]-2-methylbutanoic acid.
| Compound Name | 2-[[(dimethylamino)methyl-[2,6-di(propan-2-yl)phenoxy]phosphoryl]amino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 174884485 |
| Molecular Formula | C20H35N2O4P |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 2-[[(dimethylamino)methyl-[2,6-di(propan-2-yl)phenoxy]phosphoryl]amino]-2-methylbutanoic acid |
| SMILES | CCC(C)(NP(=O)(CN(C)C)Oc1c(C(C)C)cccc1C(C)C)C(=O)O |
| InChI | InChI=1S/C20H35N2O4P/c1-9-20(6,19(23)24)21-27(25,13-22(7)8)26-18-16(14(2)3)11-10-12-17(18)15(4)5/h10-12,14-15H,9,13H2,1-8H3,(H,21,25)(H,23,24) |
| InChIKey | NNVCMCQJADDWBF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|