C24H38NO5P — CID 174884503
2-[[[2,6-bis[(1R)-1-cyclopropylethyl]phenoxy]-(methoxymethyl)phosphoryl]amino]-2,3-dimethylbutanoic acid (PubChem CID 174884503) has the molecular formula C24H38NO5P and a molecular weight of 451.54 g/mol. Its IUPAC name is 2-[[[2,6-bis[(1R)-1-cyclopropylethyl]phenoxy]-(methoxymethyl)phosphoryl]amino]-2,3-dimethylbutanoic acid.
| Compound Name | 2-[[[2,6-bis[(1R)-1-cyclopropylethyl]phenoxy]-(methoxymethyl)phosphoryl]amino]-2,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 174884503 |
| Molecular Formula | C24H38NO5P |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 2-[[[2,6-bis[(1R)-1-cyclopropylethyl]phenoxy]-(methoxymethyl)phosphoryl]amino]-2,3-dimethylbutanoic acid |
| SMILES | COCP(=O)(NC(C)(C(=O)O)C(C)C)Oc1c([C@H](C)C2CC2)cccc1[C@H](C)C1CC1 |
| InChI | InChI=1S/C24H38NO5P/c1-15(2)24(5,23(26)27)25-31(28,14-29-6)30-22-20(16(3)18-10-11-18)8-7-9-21(22)17(4)19-12-13-19/h7-9,15-19H,10-14H2,1-6H3,(H,25,28)(H,26,27)/t16-,17-,24?,31?/m1/s1 |
| InChIKey | YWKSZBYKQJLFDC-DGNSVJKXSA-N |
| XLogP | 5.98 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|