C22H28NO7P — CID 174885107
2-[[[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]-(methoxymethyl)phosphoryl]amino]-2,3-dimethylbutanoic acid (PubChem CID 174885107) has the molecular formula C22H28NO7P and a molecular weight of 449.44 g/mol. Its IUPAC name is 2-[[[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]-(methoxymethyl)phosphoryl]amino]-2,3-dimethylbutanoic acid.
| Compound Name | 2-[[[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]-(methoxymethyl)phosphoryl]amino]-2,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 174885107 |
| Molecular Formula | C22H28NO7P |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 2-[[[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]-(methoxymethyl)phosphoryl]amino]-2,3-dimethylbutanoic acid |
| SMILES | COCP(=O)(NC(C)(C(=O)O)C(C)C)Oc1ccc(/C=C/c2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C22H28NO7P/c1-15(2)22(3,21(26)27)23-31(28,14-29-4)30-20-9-7-16(8-10-20)5-6-17-11-18(24)13-19(25)12-17/h5-13,15,24-25H,14H2,1-4H3,(H,23,28)(H,26,27)/b6-5+ |
| InChIKey | AANKBRUIYZYFBY-AATRIKPKSA-N |
| XLogP | 4.53 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|