C29H38O7 — CID 50925388
5-[4-[(E)-2-[3-(4-carboxy-4-methylpentoxy)-5-methoxyphenyl]ethenyl]phenoxy]-2,2-dimethylpentanoic acid (PubChem CID 50925388) has the molecular formula C29H38O7 and a molecular weight of 498.62 g/mol. Its IUPAC name is 5-[4-[(E)-2-[3-(4-carboxy-4-methylpentoxy)-5-methoxyphenyl]ethenyl]phenoxy]-2,2-dimethylpentanoic acid.
| Compound Name | 5-[4-[(E)-2-[3-(4-carboxy-4-methylpentoxy)-5-methoxyphenyl]ethenyl]phenoxy]-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 50925388 |
| Molecular Formula | C29H38O7 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 5-[4-[(E)-2-[3-(4-carboxy-4-methylpentoxy)-5-methoxyphenyl]ethenyl]phenoxy]-2,2-dimethylpentanoic acid |
| SMILES | COc1cc(/C=C/c2ccc(OCCCC(C)(C)C(=O)O)cc2)cc(OCCCC(C)(C)C(=O)O)c1 |
| InChI | InChI=1S/C29H38O7/c1-28(2,26(30)31)14-6-16-35-23-12-10-21(11-13-23)8-9-22-18-24(34-5)20-25(19-22)36-17-7-15-29(3,4)27(32)33/h8-13,18-20H,6-7,14-17H2,1-5H3,(H,30,31)(H,32,33)/b9-8+ |
| InChIKey | BLQRATSSPOUCKI-CMDGGOBGSA-N |
| XLogP | 6.41 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|