C26H34O6 — CID 13050541
5-[4-[4-(4-carboxy-4-methylpentoxy)phenyl]phenoxy]-2,2-dimethylpentanoic acid (PubChem CID 13050541) has the molecular formula C26H34O6 and a molecular weight of 442.55 g/mol. Its IUPAC name is 5-[4-[4-(4-carboxy-4-methylpentoxy)phenyl]phenoxy]-2,2-dimethylpentanoic acid.
| Compound Name | 5-[4-[4-(4-carboxy-4-methylpentoxy)phenyl]phenoxy]-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 13050541 |
| Molecular Formula | C26H34O6 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 5-[4-[4-(4-carboxy-4-methylpentoxy)phenyl]phenoxy]-2,2-dimethylpentanoic acid |
| SMILES | CC(C)(CCCOc1ccc(-c2ccc(OCCCC(C)(C)C(=O)O)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C26H34O6/c1-25(2,23(27)28)15-5-17-31-21-11-7-19(8-12-21)20-9-13-22(14-10-20)32-18-6-16-26(3,4)24(29)30/h7-14H,5-6,15-18H2,1-4H3,(H,27,28)(H,29,30) |
| InChIKey | FJCZJUUEWDDUCD-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|