C18H28O3 — CID 107668766
6-(4-butan-2-ylphenoxy)-2,2-dimethylhexanoic acid (PubChem CID 107668766) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is 6-(4-butan-2-ylphenoxy)-2,2-dimethylhexanoic acid.
| Compound Name | 6-(4-butan-2-ylphenoxy)-2,2-dimethylhexanoic acid |
|---|---|
| PubChem CID | 107668766 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 6-(4-butan-2-ylphenoxy)-2,2-dimethylhexanoic acid |
| SMILES | CCC(C)c1ccc(OCCCCC(C)(C)C(=O)O)cc1 |
| InChI | InChI=1S/C18H28O3/c1-5-14(2)15-8-10-16(11-9-15)21-13-7-6-12-18(3,4)17(19)20/h8-11,14H,5-7,12-13H2,1-4H3,(H,19,20) |
| InChIKey | SLIRGIBGCAGDOB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|