C20H34O2 — CID 158163672
1-butan-2-yl-4-tert-butylbenzene;2,2-dimethylbutanoic acid (PubChem CID 158163672) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is 1-butan-2-yl-4-tert-butylbenzene;2,2-dimethylbutanoic acid.
| Compound Name | 1-butan-2-yl-4-tert-butylbenzene;2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 158163672 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 1-butan-2-yl-4-tert-butylbenzene;2,2-dimethylbutanoic acid |
| SMILES | CCC(C)(C)C(=O)O.CCC(C)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C14H22.C6H12O2/c1-6-11(2)12-7-9-13(10-8-12)14(3,4)5;1-4-6(2,3)5(7)8/h7-11H,6H2,1-5H3;4H2,1-3H3,(H,7,8) |
| InChIKey | FWORJVYTICBGHT-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |