C16H24O3 — CID 65298089
4-(4-tert-butylphenyl)-4-hydroxy-2,2-dimethylbutanoic acid (PubChem CID 65298089) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-4-hydroxy-2,2-dimethylbutanoic acid.
| Compound Name | 4-(4-tert-butylphenyl)-4-hydroxy-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 65298089 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 4-(4-tert-butylphenyl)-4-hydroxy-2,2-dimethylbutanoic acid |
| SMILES | CC(C)(CC(O)c1ccc(C(C)(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C16H24O3/c1-15(2,3)12-8-6-11(7-9-12)13(17)10-16(4,5)14(18)19/h6-9,13,17H,10H2,1-5H3,(H,18,19) |
| InChIKey | VHUVOTUXLLNSLR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |