C14H20O4 — CID 79624226
3-[4-[(1R)-1-hydroxypropyl]phenoxy]-2,2-dimethylpropanoic acid (PubChem CID 79624226) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 3-[4-[(1R)-1-hydroxypropyl]phenoxy]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[4-[(1R)-1-hydroxypropyl]phenoxy]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 79624226 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 3-[4-[(1R)-1-hydroxypropyl]phenoxy]-2,2-dimethylpropanoic acid |
| SMILES | CC[C@@H](O)c1ccc(OCC(C)(C)C(=O)O)cc1 |
| InChI | InChI=1S/C14H20O4/c1-4-12(15)10-5-7-11(8-6-10)18-9-14(2,3)13(16)17/h5-8,12,15H,4,9H2,1-3H3,(H,16,17)/t12-/m1/s1 |
| InChIKey | QLNPTEQYXXJJLJ-GFCCVEGCSA-N |
| XLogP | 2.62 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |