C109H210O32 — CID 158672015
4-butan-2-ylbenzoic acid;heptakis(2,2-dimethylbutanoic acid);octakis(methyl 2,2-dimethylbutanoate) (PubChem CID 158672015) has the molecular formula C109H210O32 and a molecular weight of 2032.85 g/mol. Its IUPAC name is 4-butan-2-ylbenzoic acid;heptakis(2,2-dimethylbutanoic acid);octakis(methyl 2,2-dimethylbutanoate).
| Compound Name | 4-butan-2-ylbenzoic acid;heptakis(2,2-dimethylbutanoic acid);octakis(methyl 2,2-dimethylbutanoate) |
|---|---|
| PubChem CID | 158672015 |
| Molecular Formula | C109H210O32 |
| Molecular Weight | 2032.85 g/mol |
| Exact Mass | 2031.48 |
| IUPAC Name | 4-butan-2-ylbenzoic acid;heptakis(2,2-dimethylbutanoic acid);octakis(methyl 2,2-dimethylbutanoate) |
| SMILES | CCC(C)(C)C(=O)O.CCC(C)(C)C(=O)O.CCC(C)(C)C(=O)O.CCC(C)(C)C(=O)O.CCC(C)(C)C(=O)O.CCC(C)(C)C(=O)O.CCC(C)(C)C(=O)O.CCC(C)(C)C(=O)OC.CCC(C)(C)C(=O)OC.CCC(C)(C)C(=O)OC.CCC(C)(C)C(=O)OC.CCC(C)(C)C(=O)OC.CCC(C)(C)C(=O)OC.CCC(C)(C)C(=O)OC.CCC(C)(C)C(=O)OC.CCC(C)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C11H14O2.8C7H14O2.7C6H12O2/c1-3-8(2)9-4-6-10(7-5-9)11(12)13;8*1-5-7(2,3)6(8)9-4;7*1-4-6(2,3)5(7)8/h4-8H,3H2,1-2H3,(H,12,13);8*5H2,1-4H3;7*4H2,1-3H3,(H,7,8) |
| InChIKey | IEBIFZCLONRASV-UHFFFAOYSA-N |
| XLogP | 26.21 |
| TPSA | 508.80 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 141 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 2032.85 |
| LogP ≤ 5 | 26.21 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|