C25H34O6 — CID 90875258
(4-butan-2-ylphenyl)methyl 3,4-dihydroxybenzoate;methyl 2,2-dimethylbutanoate (PubChem CID 90875258) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is (4-butan-2-ylphenyl)methyl 3,4-dihydroxybenzoate;methyl 2,2-dimethylbutanoate.
| Compound Name | (4-butan-2-ylphenyl)methyl 3,4-dihydroxybenzoate;methyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 90875258 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | (4-butan-2-ylphenyl)methyl 3,4-dihydroxybenzoate;methyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC.CCC(C)c1ccc(COC(=O)c2ccc(O)c(O)c2)cc1 |
| InChI | InChI=1S/C18H20O4.C7H14O2/c1-3-12(2)14-6-4-13(5-7-14)11-22-18(21)15-8-9-16(19)17(20)10-15;1-5-7(2,3)6(8)9-4/h4-10,12,19-20H,3,11H2,1-2H3;5H2,1-4H3 |
| InChIKey | QMAZAZARDULFBN-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|