C20H33NO2S — CID 123249146
(4-butan-2-ylphenyl)methyl N-[3-(2-methylbutan-2-ylsulfanyl)propyl]carbamate (PubChem CID 123249146) has the molecular formula C20H33NO2S and a molecular weight of 351.56 g/mol. Its IUPAC name is (4-butan-2-ylphenyl)methyl N-[3-(2-methylbutan-2-ylsulfanyl)propyl]carbamate.
| Compound Name | (4-butan-2-ylphenyl)methyl N-[3-(2-methylbutan-2-ylsulfanyl)propyl]carbamate |
|---|---|
| PubChem CID | 123249146 |
| Molecular Formula | C20H33NO2S |
| Molecular Weight | 351.56 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | (4-butan-2-ylphenyl)methyl N-[3-(2-methylbutan-2-ylsulfanyl)propyl]carbamate |
| SMILES | CCC(C)c1ccc(COC(=O)NCCCSC(C)(C)CC)cc1 |
| InChI | InChI=1S/C20H33NO2S/c1-6-16(3)18-11-9-17(10-12-18)15-23-19(22)21-13-8-14-24-20(4,5)7-2/h9-12,16H,6-8,13-15H2,1-5H3,(H,21,22) |
| InChIKey | LQYHAOQPTUHOPG-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.56 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|