C29H38O5 — CID 71073729
(4-butan-2-ylphenyl)methyl 3-[2-(2-cyclohexylpropan-2-yloxy)-2-oxoethoxy]benzoate (PubChem CID 71073729) has the molecular formula C29H38O5 and a molecular weight of 466.62 g/mol. Its IUPAC name is (4-butan-2-ylphenyl)methyl 3-[2-(2-cyclohexylpropan-2-yloxy)-2-oxoethoxy]benzoate.
| Compound Name | (4-butan-2-ylphenyl)methyl 3-[2-(2-cyclohexylpropan-2-yloxy)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 71073729 |
| Molecular Formula | C29H38O5 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | (4-butan-2-ylphenyl)methyl 3-[2-(2-cyclohexylpropan-2-yloxy)-2-oxoethoxy]benzoate |
| SMILES | CCC(C)c1ccc(COC(=O)c2cccc(OCC(=O)OC(C)(C)C3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C29H38O5/c1-5-21(2)23-16-14-22(15-17-23)19-33-28(31)24-10-9-13-26(18-24)32-20-27(30)34-29(3,4)25-11-7-6-8-12-25/h9-10,13-18,21,25H,5-8,11-12,19-20H2,1-4H3 |
| InChIKey | BYEQVGJRJBQZFV-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |