C31H44O4 — CID 126747371
2-cyclohexylpropan-2-yl 2-[4-[6-(4-hydroxyphenyl)octan-2-yl]phenoxy]acetate (PubChem CID 126747371) has the molecular formula C31H44O4 and a molecular weight of 480.69 g/mol. Its IUPAC name is 2-cyclohexylpropan-2-yl 2-[4-[6-(4-hydroxyphenyl)octan-2-yl]phenoxy]acetate.
| Compound Name | 2-cyclohexylpropan-2-yl 2-[4-[6-(4-hydroxyphenyl)octan-2-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 126747371 |
| Molecular Formula | C31H44O4 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | 2-cyclohexylpropan-2-yl 2-[4-[6-(4-hydroxyphenyl)octan-2-yl]phenoxy]acetate |
| SMILES | CCC(CCCC(C)c1ccc(OCC(=O)OC(C)(C)C2CCCCC2)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C31H44O4/c1-5-24(26-14-18-28(32)19-15-26)11-9-10-23(2)25-16-20-29(21-17-25)34-22-30(33)35-31(3,4)27-12-7-6-8-13-27/h14-21,23-24,27,32H,5-13,22H2,1-4H3 |
| InChIKey | PXYZFXIFSOOSGX-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |