C19H28O2 — CID 59409193
2-cyclopentylpropan-2-yl 4-butan-2-ylbenzoate (PubChem CID 59409193) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is 2-cyclopentylpropan-2-yl 4-butan-2-ylbenzoate.
| Compound Name | 2-cyclopentylpropan-2-yl 4-butan-2-ylbenzoate |
|---|---|
| PubChem CID | 59409193 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 2-cyclopentylpropan-2-yl 4-butan-2-ylbenzoate |
| SMILES | CCC(C)c1ccc(C(=O)OC(C)(C)C2CCCC2)cc1 |
| InChI | InChI=1S/C19H28O2/c1-5-14(2)15-10-12-16(13-11-15)18(20)21-19(3,4)17-8-6-7-9-17/h10-14,17H,5-9H2,1-4H3 |
| InChIKey | NOXLWIOGBKVNHK-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |