About 2-hydroxyethyl 4-butan-2-ylbenzoate
2-hydroxyethyl 4-butan-2-ylbenzoate (PubChem CID 116862879) has the molecular formula C13H18O3
and a molecular weight of 222.28 g/mol. Its IUPAC name is 2-hydroxyethyl 4-butan-2-ylbenzoate.
Molecular Properties
| Compound Name | 2-hydroxyethyl 4-butan-2-ylbenzoate |
| PubChem CID | 116862879 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 2-hydroxyethyl 4-butan-2-ylbenzoate |
| SMILES | CCC(C)c1ccc(C(=O)OCCO)cc1 |
| InChI | InChI=1S/C13H18O3/c1-3-10(2)11-4-6-12(7-5-11)13(15)16-9-8-14/h4-7,10,14H,3,8-9H2,1-2H3 |
| InChIKey | FAPKOFDJCINFHW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxyethyl 4-butan-2-ylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 4-butan-2-ylbenzoate?
The IUPAC name of 2-hydroxyethyl 4-butan-2-ylbenzoate (CID 116862879) is 2-hydroxyethyl 4-butan-2-ylbenzoate.
What is the SMILES notation for 2-hydroxyethyl 4-butan-2-ylbenzoate?
The canonical SMILES for 2-hydroxyethyl 4-butan-2-ylbenzoate is CCC(C)c1ccc(C(=O)OCCO)cc1.
What is the InChIKey of 2-hydroxyethyl 4-butan-2-ylbenzoate?
The InChIKey is FAPKOFDJCINFHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3/c1-3-10(2)11-4-6-12(7-5-11)13(15)16-9-8-14/h4-7,10,14H,3,8-9H2,1-2H3.
What are the key properties of 2-hydroxyethyl 4-butan-2-ylbenzoate?
2-hydroxyethyl 4-butan-2-ylbenzoate has a molecular weight of 222.28 g/mol, XLogP of 2.35, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 4-butan-2-ylbenzoate is sourced from PubChem (CID 116862879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).