C16H23O6P — CID 59779762
2-[(2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]ethyl 4-butan-2-ylbenzoate (PubChem CID 59779762) has the molecular formula C16H23O6P and a molecular weight of 342.33 g/mol. Its IUPAC name is 2-[(2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]ethyl 4-butan-2-ylbenzoate.
| Compound Name | 2-[(2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]ethyl 4-butan-2-ylbenzoate |
|---|---|
| PubChem CID | 59779762 |
| Molecular Formula | C16H23O6P |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-[(2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]ethyl 4-butan-2-ylbenzoate |
| SMILES | CCC(C)c1ccc(C(=O)OCCOP2(=O)OCCCO2)cc1 |
| InChI | InChI=1S/C16H23O6P/c1-3-13(2)14-5-7-15(8-6-14)16(17)19-11-12-22-23(18)20-9-4-10-21-23/h5-8,13H,3-4,9-12H2,1-2H3 |
| InChIKey | VZRSJBSEKDKXFC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|