C16H20F3O5S- — CID 176774446
5-(4-butan-2-ylbenzoyl)oxy-2,2,3-trifluoropentane-1-sulfonate (PubChem CID 176774446) has the molecular formula C16H20F3O5S- and a molecular weight of 381.39 g/mol. Its IUPAC name is 5-(4-butan-2-ylbenzoyl)oxy-2,2,3-trifluoropentane-1-sulfonate.
| Compound Name | 5-(4-butan-2-ylbenzoyl)oxy-2,2,3-trifluoropentane-1-sulfonate |
|---|---|
| PubChem CID | 176774446 |
| Molecular Formula | C16H20F3O5S- |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 5-(4-butan-2-ylbenzoyl)oxy-2,2,3-trifluoropentane-1-sulfonate |
| SMILES | CCC(C)c1ccc(C(=O)OCCC(F)C(F)(F)CS(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C16H21F3O5S/c1-3-11(2)12-4-6-13(7-5-12)15(20)24-9-8-14(17)16(18,19)10-25(21,22)23/h4-7,11,14H,3,8-10H2,1-2H3,(H,21,22,23)/p-1 |
| InChIKey | HVMRFZNBTUYXRK-UHFFFAOYSA-M |
| XLogP | 3.27 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|