C12H14F3NO3S — CID 135209714
4-butan-2-yl-N-(trifluoromethylsulfonyl)benzamide (PubChem CID 135209714) has the molecular formula C12H14F3NO3S and a molecular weight of 309.31 g/mol. Its IUPAC name is 4-butan-2-yl-N-(trifluoromethylsulfonyl)benzamide.
| Compound Name | 4-butan-2-yl-N-(trifluoromethylsulfonyl)benzamide |
|---|---|
| PubChem CID | 135209714 |
| Molecular Formula | C12H14F3NO3S |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 4-butan-2-yl-N-(trifluoromethylsulfonyl)benzamide |
| SMILES | CCC(C)c1ccc(C(=O)NS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H14F3NO3S/c1-3-8(2)9-4-6-10(7-5-9)11(17)16-20(18,19)12(13,14)15/h4-8H,3H2,1-2H3,(H,16,17) |
| InChIKey | LYRPKIIVIBIREU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |