C12H14F5NO2S — CID 90250925
N-(4-butan-2-ylphenyl)-1,1,2,2,2-pentafluoroethanesulfonamide (PubChem CID 90250925) has the molecular formula C12H14F5NO2S and a molecular weight of 331.31 g/mol. Its IUPAC name is N-(4-butan-2-ylphenyl)-1,1,2,2,2-pentafluoroethanesulfonamide.
| Compound Name | N-(4-butan-2-ylphenyl)-1,1,2,2,2-pentafluoroethanesulfonamide |
|---|---|
| PubChem CID | 90250925 |
| Molecular Formula | C12H14F5NO2S |
| Molecular Weight | 331.31 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | N-(4-butan-2-ylphenyl)-1,1,2,2,2-pentafluoroethanesulfonamide |
| SMILES | CCC(C)c1ccc(NS(=O)(=O)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H14F5NO2S/c1-3-8(2)9-4-6-10(7-5-9)18-21(19,20)12(16,17)11(13,14)15/h4-8,18H,3H2,1-2H3 |
| InChIKey | LHRZELVTSCLMGP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.31 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|