C15H19F3O6S — CID 166895711
1,1,2-trifluoro-4-[4-(2-hydroxy-2-methylpropyl)benzoyl]oxybutane-1-sulfonic acid (PubChem CID 166895711) has the molecular formula C15H19F3O6S and a molecular weight of 384.37 g/mol. Its IUPAC name is 1,1,2-trifluoro-4-[4-(2-hydroxy-2-methylpropyl)benzoyl]oxybutane-1-sulfonic acid.
| Compound Name | 1,1,2-trifluoro-4-[4-(2-hydroxy-2-methylpropyl)benzoyl]oxybutane-1-sulfonic acid |
|---|---|
| PubChem CID | 166895711 |
| Molecular Formula | C15H19F3O6S |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 1,1,2-trifluoro-4-[4-(2-hydroxy-2-methylpropyl)benzoyl]oxybutane-1-sulfonic acid |
| SMILES | CC(C)(O)Cc1ccc(C(=O)OCCC(F)C(F)(F)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C15H19F3O6S/c1-14(2,20)9-10-3-5-11(6-4-10)13(19)24-8-7-12(16)15(17,18)25(21,22)23/h3-6,12,20H,7-9H2,1-2H3,(H,21,22,23) |
| InChIKey | JDBLPQMEAFKJGX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|