C11H9F3NO5S+ — CID 162574430
2-benzoyloxy-N-(1,2,2-trifluoro-2-sulfoethyl)acetonitrilium (PubChem CID 162574430) has the molecular formula C11H9F3NO5S+ and a molecular weight of 324.26 g/mol. Its IUPAC name is 2-benzoyloxy-N-(1,2,2-trifluoro-2-sulfoethyl)acetonitrilium.
| Compound Name | 2-benzoyloxy-N-(1,2,2-trifluoro-2-sulfoethyl)acetonitrilium |
|---|---|
| PubChem CID | 162574430 |
| Molecular Formula | C11H9F3NO5S+ |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 2-benzoyloxy-N-(1,2,2-trifluoro-2-sulfoethyl)acetonitrilium |
| SMILES | O=C(OCC#[N+]C(F)C(F)(F)S(=O)(=O)O)c1ccccc1 |
| InChI | InChI=1S/C11H8F3NO5S/c12-10(11(13,14)21(17,18)19)15-6-7-20-9(16)8-4-2-1-3-5-8/h1-5,10H,7H2/p+1 |
| InChIKey | NZUAXVAKCRALMM-UHFFFAOYSA-O |
| XLogP | 1.95 |
| TPSA | 85.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|