C10H8F2O6S — CID 159099553
1,1-difluoro-2-(2-oxo-2-phenylacetyl)oxyethanesulfonic acid (PubChem CID 159099553) has the molecular formula C10H8F2O6S and a molecular weight of 294.23 g/mol. Its IUPAC name is 1,1-difluoro-2-(2-oxo-2-phenylacetyl)oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-(2-oxo-2-phenylacetyl)oxyethanesulfonic acid |
|---|---|
| PubChem CID | 159099553 |
| Molecular Formula | C10H8F2O6S |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 1,1-difluoro-2-(2-oxo-2-phenylacetyl)oxyethanesulfonic acid |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C10H8F2O6S/c11-10(12,19(15,16)17)6-18-9(14)8(13)7-4-2-1-3-5-7/h1-5H,6H2,(H,15,16,17) |
| InChIKey | DUUQQHHEQXNNAR-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|