C26H25F3O5S — CID 140543467
1,1-difluoro-2-(2-fluoro-3,3-dimethyl-2,4,4-triphenylbutanoyl)oxyethanesulfonic acid (PubChem CID 140543467) has the molecular formula C26H25F3O5S and a molecular weight of 506.54 g/mol. Its IUPAC name is 1,1-difluoro-2-(2-fluoro-3,3-dimethyl-2,4,4-triphenylbutanoyl)oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-(2-fluoro-3,3-dimethyl-2,4,4-triphenylbutanoyl)oxyethanesulfonic acid |
|---|---|
| PubChem CID | 140543467 |
| Molecular Formula | C26H25F3O5S |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | 1,1-difluoro-2-(2-fluoro-3,3-dimethyl-2,4,4-triphenylbutanoyl)oxyethanesulfonic acid |
| SMILES | CC(C)(C(c1ccccc1)c1ccccc1)C(F)(C(=O)OCC(F)(F)S(=O)(=O)O)c1ccccc1 |
| InChI | InChI=1S/C26H25F3O5S/c1-24(2,22(19-12-6-3-7-13-19)20-14-8-4-9-15-20)26(29,21-16-10-5-11-17-21)23(30)34-18-25(27,28)35(31,32)33/h3-17,22H,18H2,1-2H3,(H,31,32,33) |
| InChIKey | URQRNHFHZZKXRA-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|