C11H10F2O6S — CID 159099558
1,1-difluoro-2-(2-oxo-3-phenylpropanoyl)oxyethanesulfonic acid (PubChem CID 159099558) has the molecular formula C11H10F2O6S and a molecular weight of 308.26 g/mol. Its IUPAC name is 1,1-difluoro-2-(2-oxo-3-phenylpropanoyl)oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-(2-oxo-3-phenylpropanoyl)oxyethanesulfonic acid |
|---|---|
| PubChem CID | 159099558 |
| Molecular Formula | C11H10F2O6S |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 1,1-difluoro-2-(2-oxo-3-phenylpropanoyl)oxyethanesulfonic acid |
| SMILES | O=C(Cc1ccccc1)C(=O)OCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C11H10F2O6S/c12-11(13,20(16,17)18)7-19-10(15)9(14)6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,16,17,18) |
| InChIKey | VSGCNRXIXZIDIY-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|