C10H12F2NaO5S — CID 86669082
CID 86669082 (PubChem CID 86669082) has the molecular formula C10H12F2NaO5S and a molecular weight of 305.25 g/mol.
| Compound Name | CID 86669082 |
|---|---|
| PubChem CID | 86669082 |
| Molecular Formula | C10H12F2NaO5S |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)C(F)(F)COCC(O)c1ccccc1.[Na] |
| InChI | InChI=1S/C10H12F2O5S.Na/c11-10(12,18(14,15)16)7-17-6-9(13)8-4-2-1-3-5-8;/h1-5,9,13H,6-7H2,(H,14,15,16); |
| InChIKey | RLMJJZUVLIXBCT-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|